C11H12N4O2S — CID 7164310
(3S)-3-(5-phenyltetrazol-1-yl)thiolane 1,1-dioxide (PubChem CID 7164310) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is (3S)-3-(5-phenyltetrazol-1-yl)thiolane 1,1-dioxide.
| Compound Name | (3S)-3-(5-phenyltetrazol-1-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 7164310 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (3S)-3-(5-phenyltetrazol-1-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CC[C@H](n2nnnc2-c2ccccc2)C1 |
| InChI | InChI=1S/C11H12N4O2S/c16-18(17)7-6-10(8-18)15-11(12-13-14-15)9-4-2-1-3-5-9/h1-5,10H,6-8H2/t10-/m0/s1 |
| InChIKey | SLGWABDOGQWOCU-JTQLQIEISA-N |
| XLogP | 0.70 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |