C11H13N5O2S — CID 61352222
2-[1-(1,1-dioxothiolan-3-yl)tetrazol-5-yl]aniline (PubChem CID 61352222) has the molecular formula C11H13N5O2S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[1-(1,1-dioxothiolan-3-yl)tetrazol-5-yl]aniline.
| Compound Name | 2-[1-(1,1-dioxothiolan-3-yl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 61352222 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-[1-(1,1-dioxothiolan-3-yl)tetrazol-5-yl]aniline |
| SMILES | Nc1ccccc1-c1nnnn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13N5O2S/c12-10-4-2-1-3-9(10)11-13-14-15-16(11)8-5-6-19(17,18)7-8/h1-4,8H,5-7,12H2 |
| InChIKey | QPHOYHAFAWTEKT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|