C13H17N5O2S — CID 63924749
3-[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]-4-methylaniline (PubChem CID 63924749) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is 3-[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]-4-methylaniline.
| Compound Name | 3-[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]-4-methylaniline |
|---|---|
| PubChem CID | 63924749 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-[1-(1,1-dioxothian-3-yl)tetrazol-5-yl]-4-methylaniline |
| SMILES | Cc1ccc(N)cc1-c1nnnn1C1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17N5O2S/c1-9-4-5-10(14)7-12(9)13-15-16-17-18(13)11-3-2-6-21(19,20)8-11/h4-5,7,11H,2-3,6,8,14H2,1H3 |
| InChIKey | AEDGGHZLQBDVOL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|