C11H12FN5O2S — CID 61353877
3-[1-(1,1-dioxothiolan-3-yl)tetrazol-5-yl]-4-fluoroaniline (PubChem CID 61353877) has the molecular formula C11H12FN5O2S and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-[1-(1,1-dioxothiolan-3-yl)tetrazol-5-yl]-4-fluoroaniline.
| Compound Name | 3-[1-(1,1-dioxothiolan-3-yl)tetrazol-5-yl]-4-fluoroaniline |
|---|---|
| PubChem CID | 61353877 |
| Molecular Formula | C11H12FN5O2S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-[1-(1,1-dioxothiolan-3-yl)tetrazol-5-yl]-4-fluoroaniline |
| SMILES | Nc1ccc(F)c(-c2nnnn2C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C11H12FN5O2S/c12-10-2-1-7(13)5-9(10)11-14-15-16-17(11)8-3-4-20(18,19)6-8/h1-2,5,8H,3-4,6,13H2 |
| InChIKey | PNOLTUARVUVDAH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|