C14H20N6 — CID 61353836
4-[1-(3-methylcyclohexyl)tetrazol-5-yl]benzene-1,3-diamine (PubChem CID 61353836) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 4-[1-(3-methylcyclohexyl)tetrazol-5-yl]benzene-1,3-diamine.
| Compound Name | 4-[1-(3-methylcyclohexyl)tetrazol-5-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 61353836 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 4-[1-(3-methylcyclohexyl)tetrazol-5-yl]benzene-1,3-diamine |
| SMILES | CC1CCCC(n2nnnc2-c2ccc(N)cc2N)C1 |
| InChI | InChI=1S/C14H20N6/c1-9-3-2-4-11(7-9)20-14(17-18-19-20)12-6-5-10(15)8-13(12)16/h5-6,8-9,11H,2-4,7,15-16H2,1H3 |
| InChIKey | CPYQMECSKFPBPX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|