C13H15F2N5 — CID 114550868
4,5-difluoro-2-[1-(3-methylcyclopentyl)tetrazol-5-yl]aniline (PubChem CID 114550868) has the molecular formula C13H15F2N5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 4,5-difluoro-2-[1-(3-methylcyclopentyl)tetrazol-5-yl]aniline.
| Compound Name | 4,5-difluoro-2-[1-(3-methylcyclopentyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 114550868 |
| Molecular Formula | C13H15F2N5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4,5-difluoro-2-[1-(3-methylcyclopentyl)tetrazol-5-yl]aniline |
| SMILES | CC1CCC(n2nnnc2-c2cc(F)c(F)cc2N)C1 |
| InChI | InChI=1S/C13H15F2N5/c1-7-2-3-8(4-7)20-13(17-18-19-20)9-5-10(14)11(15)6-12(9)16/h5-8H,2-4,16H2,1H3 |
| InChIKey | ZMBRUDXHKMSJNM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|