C16H23N5 — CID 64733099
4-[1-(3,5-dimethylcyclohexyl)tetrazol-5-yl]-2-methylaniline (PubChem CID 64733099) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[1-(3,5-dimethylcyclohexyl)tetrazol-5-yl]-2-methylaniline.
| Compound Name | 4-[1-(3,5-dimethylcyclohexyl)tetrazol-5-yl]-2-methylaniline |
|---|---|
| PubChem CID | 64733099 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-[1-(3,5-dimethylcyclohexyl)tetrazol-5-yl]-2-methylaniline |
| SMILES | Cc1cc(-c2nnnn2C2CC(C)CC(C)C2)ccc1N |
| InChI | InChI=1S/C16H23N5/c1-10-6-11(2)8-14(7-10)21-16(18-19-20-21)13-4-5-15(17)12(3)9-13/h4-5,9-11,14H,6-8,17H2,1-3H3 |
| InChIKey | USNFLNPJUXPGRV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|