C13H16ClN5 — CID 114550889
2-chloro-4-[1-(3-methylcyclopentyl)tetrazol-5-yl]aniline (PubChem CID 114550889) has the molecular formula C13H16ClN5 and a molecular weight of 277.76 g/mol. Its IUPAC name is 2-chloro-4-[1-(3-methylcyclopentyl)tetrazol-5-yl]aniline.
| Compound Name | 2-chloro-4-[1-(3-methylcyclopentyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 114550889 |
| Molecular Formula | C13H16ClN5 |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-chloro-4-[1-(3-methylcyclopentyl)tetrazol-5-yl]aniline |
| SMILES | CC1CCC(n2nnnc2-c2ccc(N)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H16ClN5/c1-8-2-4-10(6-8)19-13(16-17-18-19)9-3-5-12(15)11(14)7-9/h3,5,7-8,10H,2,4,6,15H2,1H3 |
| InChIKey | BWYADAFFTFAISH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|