C14H17Cl2N5 — CID 61354472
2,3-dichloro-5-(1-cycloheptyltetrazol-5-yl)aniline (PubChem CID 61354472) has the molecular formula C14H17Cl2N5 and a molecular weight of 326.23 g/mol. Its IUPAC name is 2,3-dichloro-5-(1-cycloheptyltetrazol-5-yl)aniline.
| Compound Name | 2,3-dichloro-5-(1-cycloheptyltetrazol-5-yl)aniline |
|---|---|
| PubChem CID | 61354472 |
| Molecular Formula | C14H17Cl2N5 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2,3-dichloro-5-(1-cycloheptyltetrazol-5-yl)aniline |
| SMILES | Nc1cc(-c2nnnn2C2CCCCCC2)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl2N5/c15-11-7-9(8-12(17)13(11)16)14-18-19-20-21(14)10-5-3-1-2-4-6-10/h7-8,10H,1-6,17H2 |
| InChIKey | GJKHPGVPLQJIAN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|