C12H13Cl2N5 — CID 107199675
3,4-dichloro-5-[1-(3-methylcyclobutyl)tetrazol-5-yl]aniline (PubChem CID 107199675) has the molecular formula C12H13Cl2N5 and a molecular weight of 298.18 g/mol. Its IUPAC name is 3,4-dichloro-5-[1-(3-methylcyclobutyl)tetrazol-5-yl]aniline.
| Compound Name | 3,4-dichloro-5-[1-(3-methylcyclobutyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 107199675 |
| Molecular Formula | C12H13Cl2N5 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3,4-dichloro-5-[1-(3-methylcyclobutyl)tetrazol-5-yl]aniline |
| SMILES | CC1CC(n2nnnc2-c2cc(N)cc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C12H13Cl2N5/c1-6-2-8(3-6)19-12(16-17-18-19)9-4-7(15)5-10(13)11(9)14/h4-6,8H,2-3,15H2,1H3 |
| InChIKey | NSKZACOHQCVQRP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|