C11H9Cl2N7 — CID 107199619
3,4-dichloro-5-[1-(1-methylpyrazol-4-yl)tetrazol-5-yl]aniline (PubChem CID 107199619) has the molecular formula C11H9Cl2N7 and a molecular weight of 310.15 g/mol. Its IUPAC name is 3,4-dichloro-5-[1-(1-methylpyrazol-4-yl)tetrazol-5-yl]aniline.
| Compound Name | 3,4-dichloro-5-[1-(1-methylpyrazol-4-yl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 107199619 |
| Molecular Formula | C11H9Cl2N7 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 3,4-dichloro-5-[1-(1-methylpyrazol-4-yl)tetrazol-5-yl]aniline |
| SMILES | Cn1cc(-n2nnnc2-c2cc(N)cc(Cl)c2Cl)cn1 |
| InChI | InChI=1S/C11H9Cl2N7/c1-19-5-7(4-15-19)20-11(16-17-18-20)8-2-6(14)3-9(12)10(8)13/h2-5H,14H2,1H3 |
| InChIKey | KFCQLEOGTWURGA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|