C12H15Cl2N5O2 — CID 107199505
3,4-dichloro-5-[1-[2-(2-methoxyethoxy)ethyl]tetrazol-5-yl]aniline (PubChem CID 107199505) has the molecular formula C12H15Cl2N5O2 and a molecular weight of 332.19 g/mol. Its IUPAC name is 3,4-dichloro-5-[1-[2-(2-methoxyethoxy)ethyl]tetrazol-5-yl]aniline.
| Compound Name | 3,4-dichloro-5-[1-[2-(2-methoxyethoxy)ethyl]tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 107199505 |
| Molecular Formula | C12H15Cl2N5O2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3,4-dichloro-5-[1-[2-(2-methoxyethoxy)ethyl]tetrazol-5-yl]aniline |
| SMILES | COCCOCCn1nnnc1-c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H15Cl2N5O2/c1-20-4-5-21-3-2-19-12(16-17-18-19)9-6-8(15)7-10(13)11(9)14/h6-7H,2-5,15H2,1H3 |
| InChIKey | JGOWIRYDIGQUOO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|