C13H15Cl2N5 — CID 107199568
3,4-dichloro-5-[1-(1-cyclopropylpropan-2-yl)tetrazol-5-yl]aniline (PubChem CID 107199568) has the molecular formula C13H15Cl2N5 and a molecular weight of 312.20 g/mol. Its IUPAC name is 3,4-dichloro-5-[1-(1-cyclopropylpropan-2-yl)tetrazol-5-yl]aniline.
| Compound Name | 3,4-dichloro-5-[1-(1-cyclopropylpropan-2-yl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 107199568 |
| Molecular Formula | C13H15Cl2N5 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3,4-dichloro-5-[1-(1-cyclopropylpropan-2-yl)tetrazol-5-yl]aniline |
| SMILES | CC(CC1CC1)n1nnnc1-c1cc(N)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H15Cl2N5/c1-7(4-8-2-3-8)20-13(17-18-19-20)10-5-9(16)6-11(14)12(10)15/h5-8H,2-4,16H2,1H3 |
| InChIKey | XDEMFWKCZQOIKJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|