C14H17F2N5 — CID 61377002
2,4-difluoro-5-[1-(4-methylcyclohexyl)tetrazol-5-yl]aniline (PubChem CID 61377002) has the molecular formula C14H17F2N5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2,4-difluoro-5-[1-(4-methylcyclohexyl)tetrazol-5-yl]aniline.
| Compound Name | 2,4-difluoro-5-[1-(4-methylcyclohexyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 61377002 |
| Molecular Formula | C14H17F2N5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2,4-difluoro-5-[1-(4-methylcyclohexyl)tetrazol-5-yl]aniline |
| SMILES | CC1CCC(n2nnnc2-c2cc(N)c(F)cc2F)CC1 |
| InChI | InChI=1S/C14H17F2N5/c1-8-2-4-9(5-3-8)21-14(18-19-20-21)10-6-13(17)12(16)7-11(10)15/h6-9H,2-5,17H2,1H3 |
| InChIKey | FBVBBNJYHNTUJD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|