C11H13N5 — CID 63090376
4-(1-cyclopropyltetrazol-5-yl)-N-methylaniline (PubChem CID 63090376) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 4-(1-cyclopropyltetrazol-5-yl)-N-methylaniline.
| Compound Name | 4-(1-cyclopropyltetrazol-5-yl)-N-methylaniline |
|---|---|
| PubChem CID | 63090376 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 4-(1-cyclopropyltetrazol-5-yl)-N-methylaniline |
| SMILES | CNc1ccc(-c2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C11H13N5/c1-12-9-4-2-8(3-5-9)11-13-14-15-16(11)10-6-7-10/h2-5,10,12H,6-7H2,1H3 |
| InChIKey | CQBHQRYOLVMPMK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |