C15H15Cl2N5O — CID 39974905
(1R)-2,2-dichloro-N-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 39974905) has the molecular formula C15H15Cl2N5O and a molecular weight of 352.23 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 39974905 |
| Molecular Formula | C15H15Cl2N5O |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (1R)-2,2-dichloro-N-[4-(1-cyclopropyltetrazol-5-yl)phenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)Nc2ccc(-c3nnnn3C3CC3)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C15H15Cl2N5O/c1-14(8-15(14,16)17)13(23)18-10-4-2-9(3-5-10)12-19-20-21-22(12)11-6-7-11/h2-5,11H,6-8H2,1H3,(H,18,23)/t14-/m1/s1 |
| InChIKey | RAFJUJJHCIMCRN-CQSZACIVSA-N |
| XLogP | 3.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|