C13H16N4O2S — CID 43336820
1-(1,1-dioxothiolan-3-yl)-4-methyl-3-pyridin-3-ylpyrazol-5-amine (PubChem CID 43336820) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4-methyl-3-pyridin-3-ylpyrazol-5-amine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-4-methyl-3-pyridin-3-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 43336820 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-4-methyl-3-pyridin-3-ylpyrazol-5-amine |
| SMILES | Cc1c(-c2cccnc2)nn(C2CCS(=O)(=O)C2)c1N |
| InChI | InChI=1S/C13H16N4O2S/c1-9-12(10-3-2-5-15-7-10)16-17(13(9)14)11-4-6-20(18,19)8-11/h2-3,5,7,11H,4,6,8,14H2,1H3 |
| InChIKey | HARSGRJHSKSMDL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |