C17H19N2O3S+ — CID 8876318
N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-phenylpyridin-1-ium-1-yl)acetamide (PubChem CID 8876318) has the molecular formula C17H19N2O3S+ and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-phenylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-phenylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8876318 |
| Molecular Formula | C17H19N2O3S+ |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-(3-phenylpyridin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[n+]1cccc(-c2ccccc2)c1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H18N2O3S/c20-17(18-16-8-10-23(21,22)13-16)12-19-9-4-7-15(11-19)14-5-2-1-3-6-14/h1-7,9,11,16H,8,10,12-13H2/p+1/t16-/m1/s1 |
| InChIKey | FFDJXHUIAJLCQU-MRXNPFEDSA-O |
| XLogP | 0.94 |
| TPSA | 67.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|