C15H21N2O3S+ — CID 8876872
N-[(3S)-1,1-dioxothiolan-3-yl]-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide (PubChem CID 8876872) has the molecular formula C15H21N2O3S+ and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
|---|---|
| PubChem CID | 8876872 |
| Molecular Formula | C15H21N2O3S+ |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
| SMILES | O=C(C[n+]1ccc2c(c1)CCCC2)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20N2O3S/c18-15(16-14-6-8-21(19,20)11-14)10-17-7-5-12-3-1-2-4-13(12)9-17/h5,7,9,14H,1-4,6,8,10-11H2/p+1/t14-/m0/s1 |
| InChIKey | SBFVYWJHJGNAFU-AWEZNQCLSA-O |
| XLogP | 0.16 |
| TPSA | 67.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|