C13H20N3O3S+ — CID 8864354
2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 8864354) has the molecular formula C13H20N3O3S+ and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 8864354 |
| Molecular Formula | C13H20N3O3S+ |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[4-(dimethylamino)pyridin-1-ium-1-yl]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CN(C)c1cc[n+](CC(=O)N[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H19N3O3S/c1-15(2)12-3-6-16(7-4-12)9-13(17)14-11-5-8-20(18,19)10-11/h3-4,6-7,11H,5,8-10H2,1-2H3/p+1/t11-/m1/s1 |
| InChIKey | NEJMTRJBACYXCG-LLVKDONJSA-O |
| XLogP | -0.66 |
| TPSA | 70.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|