C17H26N4O4S — CID 51961749
2-[[4-(dimethylamino)phenyl]methylcarbamoyl-methylamino]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 51961749) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)phenyl]methylcarbamoyl-methylamino]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[[4-(dimethylamino)phenyl]methylcarbamoyl-methylamino]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 51961749 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2-[[4-(dimethylamino)phenyl]methylcarbamoyl-methylamino]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CN(CC(=O)N[C@H]1CCS(=O)(=O)C1)C(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H26N4O4S/c1-20(2)15-6-4-13(5-7-15)10-18-17(23)21(3)11-16(22)19-14-8-9-26(24,25)12-14/h4-7,14H,8-12H2,1-3H3,(H,18,23)(H,19,22)/t14-/m0/s1 |
| InChIKey | HGCJEQIBNSELBB-AWEZNQCLSA-N |
| XLogP | 0.20 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|