C16H24N2O3S — CID 99932600
3-[4-(dimethylamino)phenyl]-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]propanamide (PubChem CID 99932600) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]propanamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 99932600 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]propanamide |
| SMILES | CN(C)c1ccc(CCC(=O)NC[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H24N2O3S/c1-18(2)15-6-3-13(4-7-15)5-8-16(19)17-11-14-9-10-22(20,21)12-14/h3-4,6-7,14H,5,8-12H2,1-2H3,(H,17,19)/t14-/m1/s1 |
| InChIKey | COUAYHJPDZYDPT-CQSZACIVSA-N |
| XLogP | 1.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|