C14H18N2O3S2 — CID 63612862
2-(4-carbamothioylphenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]acetamide (PubChem CID 63612862) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-(4-carbamothioylphenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]acetamide.
| Compound Name | 2-(4-carbamothioylphenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 63612862 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-(4-carbamothioylphenyl)-N-[(1,1-dioxothiolan-3-yl)methyl]acetamide |
| SMILES | NC(=S)c1ccc(CC(=O)NCC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H18N2O3S2/c15-14(20)12-3-1-10(2-4-12)7-13(17)16-8-11-5-6-21(18,19)9-11/h1-4,11H,5-9H2,(H2,15,20)(H,16,17) |
| InChIKey | YSRKEIRSTAXXBT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|