C10H16N2O3S2 — CID 80589592
1-carbamothioyl-N-[(1,1-dioxothiolan-3-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 80589592) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-carbamothioyl-N-[(1,1-dioxothiolan-3-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-[(1,1-dioxothiolan-3-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80589592 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1-carbamothioyl-N-[(1,1-dioxothiolan-3-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)NCC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C10H16N2O3S2/c11-8(16)10(2-3-10)9(13)12-5-7-1-4-17(14,15)6-7/h7H,1-6H2,(H2,11,16)(H,12,13) |
| InChIKey | QGIODQUXQHKZKG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|