C9H15NO3S2 — CID 43827882
O-prop-2-enyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate (PubChem CID 43827882) has the molecular formula C9H15NO3S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is O-prop-2-enyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate.
| Compound Name | O-prop-2-enyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate |
|---|---|
| PubChem CID | 43827882 |
| Molecular Formula | C9H15NO3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | O-prop-2-enyl N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate |
| SMILES | C=CCOC(=S)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H15NO3S2/c1-2-4-13-9(14)10-6-8-3-5-15(11,12)7-8/h2,8H,1,3-7H2,(H,10,14) |
| InChIKey | FNUVRMYSEFFVHT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|