C13H17NO4S2 — CID 102566969
O-(3-methoxyphenyl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate (PubChem CID 102566969) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is O-(3-methoxyphenyl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate.
| Compound Name | O-(3-methoxyphenyl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate |
|---|---|
| PubChem CID | 102566969 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | O-(3-methoxyphenyl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate |
| SMILES | COc1cccc(OC(=S)NCC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H17NO4S2/c1-17-11-3-2-4-12(7-11)18-13(19)14-8-10-5-6-20(15,16)9-10/h2-4,7,10H,5-6,8-9H2,1H3,(H,14,19) |
| InChIKey | ILQKAAWTDMCYHV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|