C12H14ClNO3S2 — CID 102566946
O-(3-chlorophenyl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate (PubChem CID 102566946) has the molecular formula C12H14ClNO3S2 and a molecular weight of 319.83 g/mol. Its IUPAC name is O-(3-chlorophenyl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate.
| Compound Name | O-(3-chlorophenyl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate |
|---|---|
| PubChem CID | 102566946 |
| Molecular Formula | C12H14ClNO3S2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | O-(3-chlorophenyl) N-[(1,1-dioxothiolan-3-yl)methyl]carbamothioate |
| SMILES | O=S1(=O)CCC(CNC(=S)Oc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C12H14ClNO3S2/c13-10-2-1-3-11(6-10)17-12(18)14-7-9-4-5-19(15,16)8-9/h1-3,6,9H,4-5,7-8H2,(H,14,18) |
| InChIKey | VXEZVYPDUVDLTE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|