C18H26ClN3O2S — CID 119148761
2-[(3-chlorophenyl)methyl]-1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]guanidine (PubChem CID 119148761) has the molecular formula C18H26ClN3O2S and a molecular weight of 383.95 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]guanidine.
| Compound Name | 2-[(3-chlorophenyl)methyl]-1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119148761 |
| Molecular Formula | C18H26ClN3O2S |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]guanidine |
| SMILES | O=S1(=O)CCC(CN/C(=N\Cc2cccc(Cl)c2)NC2CCCC2)C1 |
| InChI | InChI=1S/C18H26ClN3O2S/c19-16-5-3-4-14(10-16)11-20-18(22-17-6-1-2-7-17)21-12-15-8-9-25(23,24)13-15/h3-5,10,15,17H,1-2,6-9,11-13H2,(H2,20,21,22) |
| InChIKey | GPACUFSDCHHQCX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|