C18H27FIN3O2S — CID 119148764
1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-[(2-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 119148764) has the molecular formula C18H27FIN3O2S and a molecular weight of 495.40 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-[(2-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-[(2-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119148764 |
| Molecular Formula | C18H27FIN3O2S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-[(2-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | I.O=S1(=O)CCC(CN/C(=N\Cc2ccccc2F)NC2CCCC2)C1 |
| InChI | InChI=1S/C18H26FN3O2S.HI/c19-17-8-4-1-5-15(17)12-21-18(22-16-6-2-3-7-16)20-11-14-9-10-25(23,24)13-14;/h1,4-5,8,14,16H,2-3,6-7,9-13H2,(H2,20,21,22);1H |
| InChIKey | SDSHJWOHYZZDAC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|