C17H26FIN4O — CID 111841577
2-[[N-cyclopentyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111841577) has the molecular formula C17H26FIN4O and a molecular weight of 448.32 g/mol. Its IUPAC name is 2-[[N-cyclopentyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-cyclopentyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111841577 |
| Molecular Formula | C17H26FIN4O |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-[[N-cyclopentyl-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1ccccc1F)NC1CCCC1.I |
| InChI | InChI=1S/C17H25FN4O.HI/c1-22(2)16(23)12-20-17(21-14-8-4-5-9-14)19-11-13-7-3-6-10-15(13)18;/h3,6-7,10,14H,4-5,8-9,11-12H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | BGCBNHCHZXDDDB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|