C24H32FN5O — CID 111265455
2-[[N-(1-benzylpiperidin-4-yl)-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111265455) has the molecular formula C24H32FN5O and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[[N-(1-benzylpiperidin-4-yl)-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N-(1-benzylpiperidin-4-yl)-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111265455 |
| Molecular Formula | C24H32FN5O |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 2-[[N-(1-benzylpiperidin-4-yl)-N'-[(2-fluorophenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1ccccc1F)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H32FN5O/c1-29(2)23(31)17-27-24(26-16-20-10-6-7-11-22(20)25)28-21-12-14-30(15-13-21)18-19-8-4-3-5-9-19/h3-11,21H,12-18H2,1-2H3,(H2,26,27,28) |
| InChIKey | ZMVYSJLUGMOFEM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|