C14H20N2O5S2 — CID 47023694
N-[(1,1-dioxothiolan-3-yl)methyl]-3-(4-sulfamoylphenyl)propanamide (PubChem CID 47023694) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-3-(4-sulfamoylphenyl)propanamide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-3-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 47023694 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-3-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(CCC(=O)NCC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H20N2O5S2/c15-23(20,21)13-4-1-11(2-5-13)3-6-14(17)16-9-12-7-8-22(18,19)10-12/h1-2,4-5,12H,3,6-10H2,(H,16,17)(H2,15,20,21) |
| InChIKey | HOOOMIVMCNJGON-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |