C17H23NO3S — CID 95287712
(E)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-3-methyl-5-phenylpent-2-enamide (PubChem CID 95287712) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is (E)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-3-methyl-5-phenylpent-2-enamide.
| Compound Name | (E)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-3-methyl-5-phenylpent-2-enamide |
|---|---|
| PubChem CID | 95287712 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (E)-N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-3-methyl-5-phenylpent-2-enamide |
| SMILES | C/C(=C\C(=O)NC[C@@H]1CCS(=O)(=O)C1)CCc1ccccc1 |
| InChI | InChI=1S/C17H23NO3S/c1-14(7-8-15-5-3-2-4-6-15)11-17(19)18-12-16-9-10-22(20,21)13-16/h2-6,11,16H,7-10,12-13H2,1H3,(H,18,19)/b14-11+/t16-/m0/s1 |
| InChIKey | BDMMWQNPGJLDJY-UKYUDJEDSA-N |
| XLogP | 2.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|