C14H20N2O3S — CID 94216251
N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-(N-methylanilino)acetamide (PubChem CID 94216251) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-(N-methylanilino)acetamide.
| Compound Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-(N-methylanilino)acetamide |
|---|---|
| PubChem CID | 94216251 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-2-(N-methylanilino)acetamide |
| SMILES | CN(CC(=O)NC[C@H]1CCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-16(13-5-3-2-4-6-13)10-14(17)15-9-12-7-8-20(18,19)11-12/h2-6,12H,7-11H2,1H3,(H,15,17)/t12-/m1/s1 |
| InChIKey | KCRMINKTDMYATQ-GFCCVEGCSA-N |
| XLogP | 0.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |