C14H20N2O4S — CID 53498206
1-[(1,1-dioxothiolan-3-yl)methyl]-3-(2-hydroxy-2-phenylethyl)urea (PubChem CID 53498206) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(2-hydroxy-2-phenylethyl)urea.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(2-hydroxy-2-phenylethyl)urea |
|---|---|
| PubChem CID | 53498206 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(2-hydroxy-2-phenylethyl)urea |
| SMILES | O=C(NCC1CCS(=O)(=O)C1)NCC(O)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O4S/c17-13(12-4-2-1-3-5-12)9-16-14(18)15-8-11-6-7-21(19,20)10-11/h1-5,11,13,17H,6-10H2,(H2,15,16,18) |
| InChIKey | HLTDXRNVZJQFKK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |