3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid

C14H19NO4S — CID 64567525

IUPAC3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid
SMILESO=C(O)C(CNCC1CCS(=O)(=O)C1)c1ccccc1
InChIInChI=1S/C14H19NO4S/c16-14(17)13(12-4-2-1-3-5-12)9-15-8-11-6-7-20(18,19)10-11/h1-5,11,13,15H,6-10H2,(H,16,17)
InChIKeyYUHJXTVWBBCETR-UHFFFAOYSA-N
MW297.38 g/mol
LogP0.88
Rot. Bonds6

About 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid

3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid (PubChem CID 64567525) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid.

Molecular Properties

Compound Name3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid
PubChem CID64567525
Molecular FormulaC14H19NO4S
Molecular Weight297.38 g/mol
Exact Mass297.10
IUPAC Name3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid
SMILESO=C(O)C(CNCC1CCS(=O)(=O)C1)c1ccccc1
InChIInChI=1S/C14H19NO4S/c16-14(17)13(12-4-2-1-3-5-12)9-15-8-11-6-7-20(18,19)10-11/h1-5,11,13,15H,6-10H2,(H,16,17)
InChIKeyYUHJXTVWBBCETR-UHFFFAOYSA-N
XLogP0.88
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.38
LogP ≤ 50.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid?
The IUPAC name of 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid (CID 64567525) is 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid.
What is the SMILES notation for 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid?
The canonical SMILES for 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid is O=C(O)C(CNCC1CCS(=O)(=O)C1)c1ccccc1.
What is the InChIKey of 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid?
The InChIKey is YUHJXTVWBBCETR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4S/c16-14(17)13(12-4-2-1-3-5-12)9-15-8-11-6-7-20(18,19)10-11/h1-5,11,13,15H,6-10H2,(H,16,17).
What are the key properties of 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid?
3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid has a molecular weight of 297.38 g/mol, XLogP of 0.88, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothiolan-3-yl)methylamino]-2-phenylpropanoic acid is sourced from PubChem (CID 64567525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).