C22H29N3O2S — CID 111233857
1-[(1,1-dioxothiolan-3-yl)methyl]-3-(3,3-diphenylpropyl)-2-methylguanidine (PubChem CID 111233857) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(3,3-diphenylpropyl)-2-methylguanidine.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(3,3-diphenylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111233857 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-(3,3-diphenylpropyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCC(c1ccccc1)c1ccccc1)NCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H29N3O2S/c1-23-22(25-16-18-13-15-28(26,27)17-18)24-14-12-21(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,18,21H,12-17H2,1H3,(H2,23,24,25) |
| InChIKey | SBDCDDTZMZREFH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|