C15H23FIN3O2S — CID 111395840
1-[(1,1-dioxothiolan-3-yl)methyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111395840) has the molecular formula C15H23FIN3O2S and a molecular weight of 455.34 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111395840 |
| Molecular Formula | C15H23FIN3O2S |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1cccc(F)c1)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H22FN3O2S.HI/c1-17-15(19-10-13-6-8-22(20,21)11-13)18-7-5-12-3-2-4-14(16)9-12;/h2-4,9,13H,5-8,10-11H2,1H3,(H2,17,18,19);1H |
| InChIKey | ZYFSHBKKWNEMCR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|