C17H26FN3O2S — CID 111625092
1-[(1,1-dioxothiolan-3-yl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine (PubChem CID 111625092) has the molecular formula C17H26FN3O2S and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111625092 |
| Molecular Formula | C17H26FN3O2S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-[2-(3-fluorophenyl)-2-methylpropyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC1CCS(=O)(=O)C1)NCC(C)(C)c1cccc(F)c1 |
| InChI | InChI=1S/C17H26FN3O2S/c1-17(2,14-5-4-6-15(18)9-14)12-21-16(19-3)20-10-13-7-8-24(22,23)11-13/h4-6,9,13H,7-8,10-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | RTCYGJARIMQZFQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|