C16H25ClIN3O2S — CID 111140590
1-[2-(3-chlorophenyl)-2-methylpropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide (PubChem CID 111140590) has the molecular formula C16H25ClIN3O2S and a molecular weight of 485.82 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-2-methylpropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)-2-methylpropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111140590 |
| Molecular Formula | C16H25ClIN3O2S |
| Molecular Weight | 485.82 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-2-methylpropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)(C)c1cccc(Cl)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H24ClN3O2S.HI/c1-16(2,12-5-4-6-13(17)9-12)11-19-15(18-3)20-14-7-8-23(21,22)10-14;/h4-6,9,14H,7-8,10-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | IGHFVYYZCQDDFP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.82 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|