C18H30IN3O4S — CID 111835068
1-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide (PubChem CID 111835068) has the molecular formula C18H30IN3O4S and a molecular weight of 511.43 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111835068 |
| Molecular Formula | C18H30IN3O4S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-methylpropyl]-3-(1,1-dioxothiolan-3-yl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)(C)c1ccc(OC)c(OC)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C18H29N3O4S.HI/c1-18(2,13-6-7-15(24-4)16(10-13)25-5)12-20-17(19-3)21-14-8-9-26(22,23)11-14;/h6-7,10,14H,8-9,11-12H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | XIGUHLZGVWVDLY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|