C15H21ClN4O3S — CID 111141285
2-chloro-N-[2-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide (PubChem CID 111141285) has the molecular formula C15H21ClN4O3S and a molecular weight of 372.88 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111141285 |
| Molecular Formula | C15H21ClN4O3S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-chloro-N-[2-[[N-(1,1-dioxothiolan-3-yl)-N'-methylcarbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCNC(=O)c1ccccc1Cl)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21ClN4O3S/c1-17-15(20-11-6-9-24(22,23)10-11)19-8-7-18-14(21)12-4-2-3-5-13(12)16/h2-5,11H,6-10H2,1H3,(H,18,21)(H2,17,19,20) |
| InChIKey | KGXZMRYTJOISHU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|