C16H25ClIN3 — CID 111868661
1-[2-(3-chlorophenyl)-2-methylpropyl]-3-(cyclopropylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 111868661) has the molecular formula C16H25ClIN3 and a molecular weight of 421.75 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-2-methylpropyl]-3-(cyclopropylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)-2-methylpropyl]-3-(cyclopropylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111868661 |
| Molecular Formula | C16H25ClIN3 |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-2-methylpropyl]-3-(cyclopropylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CC1)NCC(C)(C)c1cccc(Cl)c1.I |
| InChI | InChI=1S/C16H24ClN3.HI/c1-16(2,13-5-4-6-14(17)9-13)11-20-15(18-3)19-10-12-7-8-12;/h4-6,9,12H,7-8,10-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | NKSXCFLHZLFVID-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|