C15H21F3IN3O2S — CID 111268366
1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111268366) has the molecular formula C15H21F3IN3O2S and a molecular weight of 491.32 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111268366 |
| Molecular Formula | C15H21F3IN3O2S |
| Molecular Weight | 491.32 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(C(F)(F)F)c1)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H20F3N3O2S.HI/c1-19-14(21-9-12-5-6-24(22,23)10-12)20-8-11-3-2-4-13(7-11)15(16,17)18;/h2-4,7,12H,5-6,8-10H2,1H3,(H2,19,20,21);1H |
| InChIKey | ORUGHOSYHRUJLD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|