C15H22IN3O4S — CID 111844968
1-(1,3-benzodioxol-5-ylmethyl)-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111844968) has the molecular formula C15H22IN3O4S and a molecular weight of 467.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111844968 |
| Molecular Formula | C15H22IN3O4S |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1,1-dioxothiolan-3-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCO2)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H21N3O4S.HI/c1-16-15(18-8-12-4-5-23(19,20)9-12)17-7-11-2-3-13-14(6-11)22-10-21-13;/h2-3,6,12H,4-5,7-10H2,1H3,(H2,16,17,18);1H |
| InChIKey | KNHYIDTWZQAIIN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|