C22H31N2O+ — CID 8876877
N-(1-adamantylmethyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide (PubChem CID 8876877) has the molecular formula C22H31N2O+ and a molecular weight of 339.50 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
|---|---|
| PubChem CID | 8876877 |
| Molecular Formula | C22H31N2O+ |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N-(1-adamantylmethyl)-2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetamide |
| SMILES | O=C(C[n+]1ccc2c(c1)CCCC2)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H30N2O/c25-21(14-24-6-5-19-3-1-2-4-20(19)13-24)23-15-22-10-16-7-17(11-22)9-18(8-16)12-22/h5-6,13,16-18H,1-4,7-12,14-15H2/p+1 |
| InChIKey | SUOQYSPAKJNQNH-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|