C21H23N2O5+ — CID 8876868
dimethyl 5-[[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 8876868) has the molecular formula C21H23N2O5+ and a molecular weight of 383.42 g/mol. Its IUPAC name is dimethyl 5-[[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 8876868 |
| Molecular Formula | C21H23N2O5+ |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | dimethyl 5-[[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C[n+]2ccc3c(c2)CCCC3)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H22N2O5/c1-27-20(25)16-9-17(21(26)28-2)11-18(10-16)22-19(24)13-23-8-7-14-5-3-4-6-15(14)12-23/h7-12H,3-6,13H2,1-2H3/p+1 |
| InChIKey | ULYASQRGRVCOLB-UHFFFAOYSA-O |
| XLogP | 2.06 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|