C25H26N3O3+ — CID 8876664
N-(4-methoxyphenyl)-4-[[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]amino]benzamide (PubChem CID 8876664) has the molecular formula C25H26N3O3+ and a molecular weight of 416.50 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-[[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]amino]benzamide.
| Compound Name | N-(4-methoxyphenyl)-4-[[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8876664 |
| Molecular Formula | C25H26N3O3+ |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-(4-methoxyphenyl)-4-[[2-(5,6,7,8-tetrahydroisoquinolin-2-ium-2-yl)acetyl]amino]benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)C[n+]3ccc4c(c3)CCCC4)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-31-23-12-10-22(11-13-23)27-25(30)19-6-8-21(9-7-19)26-24(29)17-28-15-14-18-4-2-3-5-20(18)16-28/h6-16H,2-5,17H2,1H3,(H-,26,27,29,30)/p+1 |
| InChIKey | WFCRMBIZPIKUQH-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|