C24H26N3O3+ — CID 8856674
N-(4-ethoxyphenyl)-4-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]benzamide (PubChem CID 8856674) has the molecular formula C24H26N3O3+ and a molecular weight of 404.49 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-4-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8856674 |
| Molecular Formula | C24H26N3O3+ |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-[[2-(4-ethylpyridin-1-ium-1-yl)acetyl]amino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=O)C[n+]3ccc(CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-3-18-13-15-27(16-14-18)17-23(28)25-20-7-5-19(6-8-20)24(29)26-21-9-11-22(12-10-21)30-4-2/h5-16H,3-4,17H2,1-2H3,(H-,25,26,28,29)/p+1 |
| InChIKey | ANLVWPHQQCGFLM-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|