C23H24ClN3O3 — CID 171114767
N-benzyl-1-[2-(4-ethoxyanilino)-2-oxoethyl]pyridin-1-ium-4-carboxamide chloride (PubChem CID 171114767) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is N-benzyl-1-[2-(4-ethoxyanilino)-2-oxoethyl]pyridin-1-ium-4-carboxamide chloride.
| Compound Name | N-benzyl-1-[2-(4-ethoxyanilino)-2-oxoethyl]pyridin-1-ium-4-carboxamide chloride |
|---|---|
| PubChem CID | 171114767 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-benzyl-1-[2-(4-ethoxyanilino)-2-oxoethyl]pyridin-1-ium-4-carboxamide chloride |
| SMILES | CCOc1ccc(NC(=O)C[n+]2ccc(C(=O)NCc3ccccc3)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C23H23N3O3.ClH/c1-2-29-21-10-8-20(9-11-21)25-22(27)17-26-14-12-19(13-15-26)23(28)24-16-18-6-4-3-5-7-18;/h3-15H,2,16-17H2,1H3,(H-,24,25,27,28);1H |
| InChIKey | PYDZWWWCIHYBIE-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|